4-(1,3-benzothiazol-2-ylmethyl)thiomorpholine-3-carboxylic acid

C13H14N2O2S2 — CID 82908778

IUPAC4-(1,3-benzothiazol-2-ylmethyl)thiomorpholine-3-carboxylic acid
SMILESO=C(O)C1CSCCN1Cc1nc2ccccc2s1
InChIInChI=1S/C13H14N2O2S2/c16-13(17)10-8-18-6-5-15(10)7-12-14-9-3-1-2-4-11(9)19-12/h1-4,10H,5-8H2,(H,16,17)
InChIKeyIIMIDLRBFXUDOQ-UHFFFAOYSA-N
MW294.40 g/mol
LogP2.30
Rot. Bonds3

About 4-(1,3-benzothiazol-2-ylmethyl)thiomorpholine-3-carboxylic acid

4-(1,3-benzothiazol-2-ylmethyl)thiomorpholine-3-carboxylic acid (PubChem CID 82908778) has the molecular formula C13H14N2O2S2 and a molecular weight of 294.40 g/mol. Its IUPAC name is 4-(1,3-benzothiazol-2-ylmethyl)thiomorpholine-3-carboxylic acid.

Molecular Properties

Compound Name4-(1,3-benzothiazol-2-ylmethyl)thiomorpholine-3-carboxylic acid
PubChem CID82908778
Molecular FormulaC13H14N2O2S2
Molecular Weight294.40 g/mol
Exact Mass294.05
IUPAC Name4-(1,3-benzothiazol-2-ylmethyl)thiomorpholine-3-carboxylic acid
SMILESO=C(O)C1CSCCN1Cc1nc2ccccc2s1
InChIInChI=1S/C13H14N2O2S2/c16-13(17)10-8-18-6-5-15(10)7-12-14-9-3-1-2-4-11(9)19-12/h1-4,10H,5-8H2,(H,16,17)
InChIKeyIIMIDLRBFXUDOQ-UHFFFAOYSA-N
XLogP2.30
TPSA53.43 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500294.40
LogP ≤ 52.30
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 4-(1,3-benzothiazol-2-ylmethyl)thiomorpholine-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(1,3-benzothiazol-2-ylmethyl)thiomorpholine-3-carboxylic acid?
The IUPAC name of 4-(1,3-benzothiazol-2-ylmethyl)thiomorpholine-3-carboxylic acid (CID 82908778) is 4-(1,3-benzothiazol-2-ylmethyl)thiomorpholine-3-carboxylic acid.
What is the SMILES notation for 4-(1,3-benzothiazol-2-ylmethyl)thiomorpholine-3-carboxylic acid?
The canonical SMILES for 4-(1,3-benzothiazol-2-ylmethyl)thiomorpholine-3-carboxylic acid is O=C(O)C1CSCCN1Cc1nc2ccccc2s1.
What is the InChIKey of 4-(1,3-benzothiazol-2-ylmethyl)thiomorpholine-3-carboxylic acid?
The InChIKey is IIMIDLRBFXUDOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N2O2S2/c16-13(17)10-8-18-6-5-15(10)7-12-14-9-3-1-2-4-11(9)19-12/h1-4,10H,5-8H2,(H,16,17).
What are the key properties of 4-(1,3-benzothiazol-2-ylmethyl)thiomorpholine-3-carboxylic acid?
4-(1,3-benzothiazol-2-ylmethyl)thiomorpholine-3-carboxylic acid has a molecular weight of 294.40 g/mol, XLogP of 2.30, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,3-benzothiazol-2-ylmethyl)thiomorpholine-3-carboxylic acid is sourced from PubChem (CID 82908778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).