C14H16N2O2S — CID 18526453
1-(1,3-benzothiazol-2-ylmethyl)piperidine-4-carboxylic acid (PubChem CID 18526453) has the molecular formula C14H16N2O2S and a molecular weight of 276.36 g/mol. Its IUPAC name is 1-(1,3-benzothiazol-2-ylmethyl)piperidine-4-carboxylic acid.
| Compound Name | 1-(1,3-benzothiazol-2-ylmethyl)piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 18526453 |
| Molecular Formula | C14H16N2O2S |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | 1-(1,3-benzothiazol-2-ylmethyl)piperidine-4-carboxylic acid |
| SMILES | O=C(O)C1CCN(Cc2nc3ccccc3s2)CC1 |
| InChI | InChI=1S/C14H16N2O2S/c17-14(18)10-5-7-16(8-6-10)9-13-15-11-3-1-2-4-12(11)19-13/h1-4,10H,5-9H2,(H,17,18) |
| InChIKey | LMEXETIORQVDGT-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |