C13H16N4OS — CID 104631136
1-(1,3-benzothiazol-2-ylmethyl)-N'-hydroxypyrrolidine-2-carboximidamide (PubChem CID 104631136) has the molecular formula C13H16N4OS and a molecular weight of 276.36 g/mol. Its IUPAC name is 1-(1,3-benzothiazol-2-ylmethyl)-N'-hydroxypyrrolidine-2-carboximidamide.
| Compound Name | 1-(1,3-benzothiazol-2-ylmethyl)-N'-hydroxypyrrolidine-2-carboximidamide |
|---|---|
| PubChem CID | 104631136 |
| Molecular Formula | C13H16N4OS |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | 1-(1,3-benzothiazol-2-ylmethyl)-N'-hydroxypyrrolidine-2-carboximidamide |
| SMILES | N/C(=N/O)C1CCCN1Cc1nc2ccccc2s1 |
| InChI | InChI=1S/C13H16N4OS/c14-13(16-18)10-5-3-7-17(10)8-12-15-9-4-1-2-6-11(9)19-12/h1-2,4,6,10,18H,3,5,7-8H2,(H2,14,16) |
| InChIKey | PFPYATXXWVDRRE-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 74.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|