C13H13N3S — CID 104631037
1-(1,3-benzothiazol-2-ylmethyl)pyrrolidine-2-carbonitrile (PubChem CID 104631037) has the molecular formula C13H13N3S and a molecular weight of 243.33 g/mol. Its IUPAC name is 1-(1,3-benzothiazol-2-ylmethyl)pyrrolidine-2-carbonitrile.
| Compound Name | 1-(1,3-benzothiazol-2-ylmethyl)pyrrolidine-2-carbonitrile |
|---|---|
| PubChem CID | 104631037 |
| Molecular Formula | C13H13N3S |
| Molecular Weight | 243.33 g/mol |
| Exact Mass | 243.08 |
| IUPAC Name | 1-(1,3-benzothiazol-2-ylmethyl)pyrrolidine-2-carbonitrile |
| SMILES | N#CC1CCCN1Cc1nc2ccccc2s1 |
| InChI | InChI=1S/C13H13N3S/c14-8-10-4-3-7-16(10)9-13-15-11-5-1-2-6-12(11)17-13/h1-2,5-6,10H,3-4,7,9H2 |
| InChIKey | OWZWVHYKILGROM-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 39.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.33 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |