C13H17N3S — CID 55104966
2-[(2-methylpiperazin-1-yl)methyl]-1,3-benzothiazole (PubChem CID 55104966) has the molecular formula C13H17N3S and a molecular weight of 247.37 g/mol. Its IUPAC name is 2-[(2-methylpiperazin-1-yl)methyl]-1,3-benzothiazole.
| Compound Name | 2-[(2-methylpiperazin-1-yl)methyl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 55104966 |
| Molecular Formula | C13H17N3S |
| Molecular Weight | 247.37 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | 2-[(2-methylpiperazin-1-yl)methyl]-1,3-benzothiazole |
| SMILES | CC1CNCCN1Cc1nc2ccccc2s1 |
| InChI | InChI=1S/C13H17N3S/c1-10-8-14-6-7-16(10)9-13-15-11-4-2-3-5-12(11)17-13/h2-5,10,14H,6-9H2,1H3 |
| InChIKey | FXQVLHHYZFMLKO-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.37 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |