C16H21N3S — CID 66208368
2-[(4-ethyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)methyl]-1,3-benzothiazole (PubChem CID 66208368) has the molecular formula C16H21N3S and a molecular weight of 287.43 g/mol. Its IUPAC name is 2-[(4-ethyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)methyl]-1,3-benzothiazole.
| Compound Name | 2-[(4-ethyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)methyl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 66208368 |
| Molecular Formula | C16H21N3S |
| Molecular Weight | 287.43 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | 2-[(4-ethyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)methyl]-1,3-benzothiazole |
| SMILES | CCC1C2CNCC2CN1Cc1nc2ccccc2s1 |
| InChI | InChI=1S/C16H21N3S/c1-2-14-12-8-17-7-11(12)9-19(14)10-16-18-13-5-3-4-6-15(13)20-16/h3-6,11-12,14,17H,2,7-10H2,1H3 |
| InChIKey | VKLOLHGVTCNBBE-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.43 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |