C17H19N3O4S — CID 166599107
(3S,8aR)-2-(1,3-benzothiazol-2-ylmethyl)-3-methyl-6,7,8,8a-tetrahydro-3H-pyrrolo[1,2-a]pyrazine-1,4-dione;formic acid (PubChem CID 166599107) has the molecular formula C17H19N3O4S and a molecular weight of 361.42 g/mol. Its IUPAC name is (3S,8aR)-2-(1,3-benzothiazol-2-ylmethyl)-3-methyl-6,7,8,8a-tetrahydro-3H-pyrrolo[1,2-a]pyrazine-1,4-dione;formic acid.
| Compound Name | (3S,8aR)-2-(1,3-benzothiazol-2-ylmethyl)-3-methyl-6,7,8,8a-tetrahydro-3H-pyrrolo[1,2-a]pyrazine-1,4-dione;formic acid |
|---|---|
| PubChem CID | 166599107 |
| Molecular Formula | C17H19N3O4S |
| Molecular Weight | 361.42 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | (3S,8aR)-2-(1,3-benzothiazol-2-ylmethyl)-3-methyl-6,7,8,8a-tetrahydro-3H-pyrrolo[1,2-a]pyrazine-1,4-dione;formic acid |
| SMILES | C[C@H]1C(=O)N2CCC[C@@H]2C(=O)N1Cc1nc2ccccc2s1.O=CO |
| InChI | InChI=1S/C16H17N3O2S.CH2O2/c1-10-15(20)18-8-4-6-12(18)16(21)19(10)9-14-17-11-5-2-3-7-13(11)22-14;2-1-3/h2-3,5,7,10,12H,4,6,8-9H2,1H3;1H,(H,2,3)/t10-,12+;/m0./s1 |
| InChIKey | TVIJRADRNRJHNG-XOZOLZJESA-N |
| XLogP | 1.72 |
| TPSA | 90.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.42 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|