C15H17ClN2O2 — CID 165418821
(3S,8aR)-2-[(3-chlorophenyl)methyl]-3-methyl-6,7,8,8a-tetrahydro-3H-pyrrolo[1,2-a]pyrazine-1,4-dione (PubChem CID 165418821) has the molecular formula C15H17ClN2O2 and a molecular weight of 292.77 g/mol. Its IUPAC name is (3S,8aR)-2-[(3-chlorophenyl)methyl]-3-methyl-6,7,8,8a-tetrahydro-3H-pyrrolo[1,2-a]pyrazine-1,4-dione.
| Compound Name | (3S,8aR)-2-[(3-chlorophenyl)methyl]-3-methyl-6,7,8,8a-tetrahydro-3H-pyrrolo[1,2-a]pyrazine-1,4-dione |
|---|---|
| PubChem CID | 165418821 |
| Molecular Formula | C15H17ClN2O2 |
| Molecular Weight | 292.77 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | (3S,8aR)-2-[(3-chlorophenyl)methyl]-3-methyl-6,7,8,8a-tetrahydro-3H-pyrrolo[1,2-a]pyrazine-1,4-dione |
| SMILES | C[C@H]1C(=O)N2CCC[C@@H]2C(=O)N1Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C15H17ClN2O2/c1-10-14(19)17-7-3-6-13(17)15(20)18(10)9-11-4-2-5-12(16)8-11/h2,4-5,8,10,13H,3,6-7,9H2,1H3/t10-,13+/m0/s1 |
| InChIKey | ZRMLNZKEMOGPEO-GXFFZTMASA-N |
| XLogP | 2.06 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.77 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |