C21H22N2O2 — CID 165428592
(3S,8aS)-3-methyl-2-[(4-phenylphenyl)methyl]-6,7,8,8a-tetrahydro-3H-pyrrolo[1,2-a]pyrazine-1,4-dione (PubChem CID 165428592) has the molecular formula C21H22N2O2 and a molecular weight of 334.42 g/mol. Its IUPAC name is (3S,8aS)-3-methyl-2-[(4-phenylphenyl)methyl]-6,7,8,8a-tetrahydro-3H-pyrrolo[1,2-a]pyrazine-1,4-dione.
| Compound Name | (3S,8aS)-3-methyl-2-[(4-phenylphenyl)methyl]-6,7,8,8a-tetrahydro-3H-pyrrolo[1,2-a]pyrazine-1,4-dione |
|---|---|
| PubChem CID | 165428592 |
| Molecular Formula | C21H22N2O2 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.17 |
| IUPAC Name | (3S,8aS)-3-methyl-2-[(4-phenylphenyl)methyl]-6,7,8,8a-tetrahydro-3H-pyrrolo[1,2-a]pyrazine-1,4-dione |
| SMILES | C[C@H]1C(=O)N2CCC[C@H]2C(=O)N1Cc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C21H22N2O2/c1-15-20(24)22-13-5-8-19(22)21(25)23(15)14-16-9-11-18(12-10-16)17-6-3-2-4-7-17/h2-4,6-7,9-12,15,19H,5,8,13-14H2,1H3/t15-,19-/m0/s1 |
| InChIKey | OBAUOHQYPOALEV-KXBFYZLASA-N |
| XLogP | 3.08 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |