C9H9N3OS — CID 2807743
2-(1,3-benzothiazol-2-yl)-N'-hydroxyethanimidamide (PubChem CID 2807743) has the molecular formula C9H9N3OS and a molecular weight of 207.26 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-yl)-N'-hydroxyethanimidamide.
| Compound Name | 2-(1,3-benzothiazol-2-yl)-N'-hydroxyethanimidamide |
|---|---|
| PubChem CID | 2807743 |
| Molecular Formula | C9H9N3OS |
| Molecular Weight | 207.26 g/mol |
| Exact Mass | 207.05 |
| IUPAC Name | 2-(1,3-benzothiazol-2-yl)-N'-hydroxyethanimidamide |
| SMILES | NC(Cc1nc2ccccc2s1)=NO |
| InChI | InChI=1S/C9H9N3OS/c10-8(12-13)5-9-11-6-3-1-2-4-7(6)14-9/h1-4,13H,5H2,(H2,10,12) |
| InChIKey | YKIOTVXPLPMYSQ-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 71.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.26 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|