C11H15ClN6S — CID 70295209
2-[2-(1,3-benzothiazol-2-yl)ethyl]-1-(diaminomethylidene)guanidine;hydrochloride (PubChem CID 70295209) has the molecular formula C11H15ClN6S and a molecular weight of 298.80 g/mol. Its IUPAC name is 2-[2-(1,3-benzothiazol-2-yl)ethyl]-1-(diaminomethylidene)guanidine;hydrochloride.
| Compound Name | 2-[2-(1,3-benzothiazol-2-yl)ethyl]-1-(diaminomethylidene)guanidine;hydrochloride |
|---|---|
| PubChem CID | 70295209 |
| Molecular Formula | C11H15ClN6S |
| Molecular Weight | 298.80 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | 2-[2-(1,3-benzothiazol-2-yl)ethyl]-1-(diaminomethylidene)guanidine;hydrochloride |
| SMILES | Cl.NC(N)=N/C(N)=N/CCc1nc2ccccc2s1 |
| InChI | InChI=1S/C11H14N6S.ClH/c12-10(13)17-11(14)15-6-5-9-16-7-3-1-2-4-8(7)18-9;/h1-4H,5-6H2,(H6,12,13,14,15,17);1H |
| InChIKey | PLGBGPOZXMMPDH-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 115.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.80 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|