C8H6N4S — CID 61372937
2-(azidomethyl)-1,3-benzothiazole (PubChem CID 61372937) has the molecular formula C8H6N4S and a molecular weight of 190.23 g/mol. Its IUPAC name is 2-(azidomethyl)-1,3-benzothiazole.
| Compound Name | 2-(azidomethyl)-1,3-benzothiazole |
|---|---|
| PubChem CID | 61372937 |
| Molecular Formula | C8H6N4S |
| Molecular Weight | 190.23 g/mol |
| Exact Mass | 190.03 |
| IUPAC Name | 2-(azidomethyl)-1,3-benzothiazole |
| SMILES | [N-]=[N+]=NCc1nc2ccccc2s1 |
| InChI | InChI=1S/C8H6N4S/c9-12-10-5-8-11-6-3-1-2-4-7(6)13-8/h1-4H,5H2 |
| InChIKey | FYJSKLWJPYYUQA-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 61.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.23 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|