C16H15N3OS — CID 157290687
[6-[N-(1,3-benzothiazol-2-ylmethyl)-C-methylcarbonimidoyl]-2-pyridinyl]methanol (PubChem CID 157290687) has the molecular formula C16H15N3OS and a molecular weight of 297.38 g/mol. Its IUPAC name is [6-[N-(1,3-benzothiazol-2-ylmethyl)-C-methylcarbonimidoyl]-2-pyridinyl]methanol.
| Compound Name | [6-[N-(1,3-benzothiazol-2-ylmethyl)-C-methylcarbonimidoyl]-2-pyridinyl]methanol |
|---|---|
| PubChem CID | 157290687 |
| Molecular Formula | C16H15N3OS |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.09 |
| IUPAC Name | [6-[N-(1,3-benzothiazol-2-ylmethyl)-C-methylcarbonimidoyl]-2-pyridinyl]methanol |
| SMILES | C/C(=N\Cc1nc2ccccc2s1)c1cccc(CO)n1 |
| InChI | InChI=1S/C16H15N3OS/c1-11(13-7-4-5-12(10-20)18-13)17-9-16-19-14-6-2-3-8-15(14)21-16/h2-8,20H,9-10H2,1H3/b17-11+ |
| InChIKey | TWEMAXIASBYCAX-GZTJUZNOSA-N |
| XLogP | 3.19 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|