C13H12N4S — CID 147361087
N-(1,3-benzothiazol-2-ylmethyl)-1-(1H-imidazol-2-yl)ethanimine (PubChem CID 147361087) has the molecular formula C13H12N4S and a molecular weight of 256.33 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-ylmethyl)-1-(1H-imidazol-2-yl)ethanimine.
| Compound Name | N-(1,3-benzothiazol-2-ylmethyl)-1-(1H-imidazol-2-yl)ethanimine |
|---|---|
| PubChem CID | 147361087 |
| Molecular Formula | C13H12N4S |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | N-(1,3-benzothiazol-2-ylmethyl)-1-(1H-imidazol-2-yl)ethanimine |
| SMILES | C/C(=N\Cc1nc2ccccc2s1)c1ncc[nH]1 |
| InChI | InChI=1S/C13H12N4S/c1-9(13-14-6-7-15-13)16-8-12-17-10-4-2-3-5-11(10)18-12/h2-7H,8H2,1H3,(H,14,15)/b16-9+ |
| InChIKey | DHGYBEOPNBJDES-CXUHLZMHSA-N |
| XLogP | 3.03 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|