C15H23IN4S — CID 111037815
2-[3-(1,3-benzothiazol-2-yl)propyl]-1,1,3,3-tetramethylguanidine;hydroiodide (PubChem CID 111037815) has the molecular formula C15H23IN4S and a molecular weight of 418.35 g/mol. Its IUPAC name is 2-[3-(1,3-benzothiazol-2-yl)propyl]-1,1,3,3-tetramethylguanidine;hydroiodide.
| Compound Name | 2-[3-(1,3-benzothiazol-2-yl)propyl]-1,1,3,3-tetramethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111037815 |
| Molecular Formula | C15H23IN4S |
| Molecular Weight | 418.35 g/mol |
| Exact Mass | 418.07 |
| IUPAC Name | 2-[3-(1,3-benzothiazol-2-yl)propyl]-1,1,3,3-tetramethylguanidine;hydroiodide |
| SMILES | CN(C)C(=NCCCc1nc2ccccc2s1)N(C)C.I |
| InChI | InChI=1S/C15H22N4S.HI/c1-18(2)15(19(3)4)16-11-7-10-14-17-12-8-5-6-9-13(12)20-14;/h5-6,8-9H,7,10-11H2,1-4H3;1H |
| InChIKey | GQEWADVNZVMSEM-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 31.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.35 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|