C16H25IN4S — CID 111037783
2-[3-(1,3-benzothiazol-2-yl)propyl]-1-(3-methylbutyl)guanidine;hydroiodide (PubChem CID 111037783) has the molecular formula C16H25IN4S and a molecular weight of 432.38 g/mol. Its IUPAC name is 2-[3-(1,3-benzothiazol-2-yl)propyl]-1-(3-methylbutyl)guanidine;hydroiodide.
| Compound Name | 2-[3-(1,3-benzothiazol-2-yl)propyl]-1-(3-methylbutyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111037783 |
| Molecular Formula | C16H25IN4S |
| Molecular Weight | 432.38 g/mol |
| Exact Mass | 432.08 |
| IUPAC Name | 2-[3-(1,3-benzothiazol-2-yl)propyl]-1-(3-methylbutyl)guanidine;hydroiodide |
| SMILES | CC(C)CCN/C(N)=N/CCCc1nc2ccccc2s1.I |
| InChI | InChI=1S/C16H24N4S.HI/c1-12(2)9-11-19-16(17)18-10-5-8-15-20-13-6-3-4-7-14(13)21-15;/h3-4,6-7,12H,5,8-11H2,1-2H3,(H3,17,18,19);1H |
| InChIKey | MPQQITGRZBINMW-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.38 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|