C18H19ClN4OS — CID 111037834
2-[3-(1,3-benzothiazol-2-yl)propyl]-1-(3-chloro-4-methoxyphenyl)guanidine (PubChem CID 111037834) has the molecular formula C18H19ClN4OS and a molecular weight of 374.90 g/mol. Its IUPAC name is 2-[3-(1,3-benzothiazol-2-yl)propyl]-1-(3-chloro-4-methoxyphenyl)guanidine.
| Compound Name | 2-[3-(1,3-benzothiazol-2-yl)propyl]-1-(3-chloro-4-methoxyphenyl)guanidine |
|---|---|
| PubChem CID | 111037834 |
| Molecular Formula | C18H19ClN4OS |
| Molecular Weight | 374.90 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | 2-[3-(1,3-benzothiazol-2-yl)propyl]-1-(3-chloro-4-methoxyphenyl)guanidine |
| SMILES | COc1ccc(N/C(N)=N/CCCc2nc3ccccc3s2)cc1Cl |
| InChI | InChI=1S/C18H19ClN4OS/c1-24-15-9-8-12(11-13(15)19)22-18(20)21-10-4-7-17-23-14-5-2-3-6-16(14)25-17/h2-3,5-6,8-9,11H,4,7,10H2,1H3,(H3,20,21,22) |
| InChIKey | WXEUQBLPIZGHHC-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 72.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.90 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|