C20H18ClIN4O2S — CID 111064333
2-[[5-(1,3-benzothiazol-2-yl)furan-2-yl]methyl]-1-(3-chloro-4-methoxyphenyl)guanidine;hydroiodide (PubChem CID 111064333) has the molecular formula C20H18ClIN4O2S and a molecular weight of 540.81 g/mol. Its IUPAC name is 2-[[5-(1,3-benzothiazol-2-yl)furan-2-yl]methyl]-1-(3-chloro-4-methoxyphenyl)guanidine;hydroiodide.
| Compound Name | 2-[[5-(1,3-benzothiazol-2-yl)furan-2-yl]methyl]-1-(3-chloro-4-methoxyphenyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111064333 |
| Molecular Formula | C20H18ClIN4O2S |
| Molecular Weight | 540.81 g/mol |
| Exact Mass | 539.99 |
| IUPAC Name | 2-[[5-(1,3-benzothiazol-2-yl)furan-2-yl]methyl]-1-(3-chloro-4-methoxyphenyl)guanidine;hydroiodide |
| SMILES | COc1ccc(N/C(N)=N/Cc2ccc(-c3nc4ccccc4s3)o2)cc1Cl.I |
| InChI | InChI=1S/C20H17ClN4O2S.HI/c1-26-16-8-6-12(10-14(16)21)24-20(22)23-11-13-7-9-17(27-13)19-25-15-4-2-3-5-18(15)28-19;/h2-10H,11H2,1H3,(H3,22,23,24);1H |
| InChIKey | JJABEJORYOZVBU-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 85.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.81 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|