C21H21IN4O3S — CID 111064315
2-[[5-(1,3-benzothiazol-2-yl)furan-2-yl]methyl]-1-(3,4-dimethoxyphenyl)guanidine;hydroiodide (PubChem CID 111064315) has the molecular formula C21H21IN4O3S and a molecular weight of 536.40 g/mol. Its IUPAC name is 2-[[5-(1,3-benzothiazol-2-yl)furan-2-yl]methyl]-1-(3,4-dimethoxyphenyl)guanidine;hydroiodide.
| Compound Name | 2-[[5-(1,3-benzothiazol-2-yl)furan-2-yl]methyl]-1-(3,4-dimethoxyphenyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111064315 |
| Molecular Formula | C21H21IN4O3S |
| Molecular Weight | 536.40 g/mol |
| Exact Mass | 536.04 |
| IUPAC Name | 2-[[5-(1,3-benzothiazol-2-yl)furan-2-yl]methyl]-1-(3,4-dimethoxyphenyl)guanidine;hydroiodide |
| SMILES | COc1ccc(N/C(N)=N/Cc2ccc(-c3nc4ccccc4s3)o2)cc1OC.I |
| InChI | InChI=1S/C21H20N4O3S.HI/c1-26-16-9-7-13(11-18(16)27-2)24-21(22)23-12-14-8-10-17(28-14)20-25-15-5-3-4-6-19(15)29-20;/h3-11H,12H2,1-2H3,(H3,22,23,24);1H |
| InChIKey | YPUGPWFUVGPKQZ-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 94.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.40 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|