C15H21IN4O3 — CID 119120502
1-(3,4-dimethoxyphenyl)-2-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]guanidine;hydroiodide (PubChem CID 119120502) has the molecular formula C15H21IN4O3 and a molecular weight of 432.26 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-2-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-(3,4-dimethoxyphenyl)-2-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 119120502 |
| Molecular Formula | C15H21IN4O3 |
| Molecular Weight | 432.26 g/mol |
| Exact Mass | 432.07 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-2-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]guanidine;hydroiodide |
| SMILES | COc1ccc(N/C(N)=N/Cc2c(C)noc2C)cc1OC.I |
| InChI | InChI=1S/C15H20N4O3.HI/c1-9-12(10(2)22-19-9)8-17-15(16)18-11-5-6-13(20-3)14(7-11)21-4;/h5-7H,8H2,1-4H3,(H3,16,17,18);1H |
| InChIKey | NYHHMMXQVCRGJW-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 94.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.26 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|