C16H23IN4O3 — CID 111806681
1-(3,4-dimethoxyphenyl)-2-[2-(3,5-dimethyl-1,2-oxazol-4-yl)ethyl]guanidine;hydroiodide (PubChem CID 111806681) has the molecular formula C16H23IN4O3 and a molecular weight of 446.29 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-2-[2-(3,5-dimethyl-1,2-oxazol-4-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 1-(3,4-dimethoxyphenyl)-2-[2-(3,5-dimethyl-1,2-oxazol-4-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111806681 |
| Molecular Formula | C16H23IN4O3 |
| Molecular Weight | 446.29 g/mol |
| Exact Mass | 446.08 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-2-[2-(3,5-dimethyl-1,2-oxazol-4-yl)ethyl]guanidine;hydroiodide |
| SMILES | COc1ccc(N/C(N)=N/CCc2c(C)noc2C)cc1OC.I |
| InChI | InChI=1S/C16H22N4O3.HI/c1-10-13(11(2)23-20-10)7-8-18-16(17)19-12-5-6-14(21-3)15(9-12)22-4;/h5-6,9H,7-8H2,1-4H3,(H3,17,18,19);1H |
| InChIKey | KELQKCYDHLNVEP-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 94.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.29 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|