C15H21IN4O2S — CID 111817273
1-(3,4-dimethoxyphenyl)-2-[2-(5-methyl-1,3-thiazol-2-yl)ethyl]guanidine;hydroiodide (PubChem CID 111817273) has the molecular formula C15H21IN4O2S and a molecular weight of 448.33 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-2-[2-(5-methyl-1,3-thiazol-2-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 1-(3,4-dimethoxyphenyl)-2-[2-(5-methyl-1,3-thiazol-2-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111817273 |
| Molecular Formula | C15H21IN4O2S |
| Molecular Weight | 448.33 g/mol |
| Exact Mass | 448.04 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-2-[2-(5-methyl-1,3-thiazol-2-yl)ethyl]guanidine;hydroiodide |
| SMILES | COc1ccc(N/C(N)=N/CCc2ncc(C)s2)cc1OC.I |
| InChI | InChI=1S/C15H20N4O2S.HI/c1-10-9-18-14(22-10)6-7-17-15(16)19-11-4-5-12(20-2)13(8-11)21-3;/h4-5,8-9H,6-7H2,1-3H3,(H3,16,17,19);1H |
| InChIKey | OZMUVNQGIYSVFA-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 81.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.33 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|