C10H19IN4O — CID 119120494
2-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-1-propan-2-ylguanidine;hydroiodide (PubChem CID 119120494) has the molecular formula C10H19IN4O and a molecular weight of 338.19 g/mol. Its IUPAC name is 2-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-1-propan-2-ylguanidine;hydroiodide.
| Compound Name | 2-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-1-propan-2-ylguanidine;hydroiodide |
|---|---|
| PubChem CID | 119120494 |
| Molecular Formula | C10H19IN4O |
| Molecular Weight | 338.19 g/mol |
| Exact Mass | 338.06 |
| IUPAC Name | 2-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-1-propan-2-ylguanidine;hydroiodide |
| SMILES | Cc1noc(C)c1C/N=C(\N)NC(C)C.I |
| InChI | InChI=1S/C10H18N4O.HI/c1-6(2)13-10(11)12-5-9-7(3)14-15-8(9)4;/h6H,5H2,1-4H3,(H3,11,12,13);1H |
| InChIKey | OQLKYURUMFKIEF-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 76.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.19 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|