C7H12N4O — CID 78989893
2-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]guanidine (PubChem CID 78989893) has the molecular formula C7H12N4O and a molecular weight of 168.20 g/mol. Its IUPAC name is 2-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]guanidine.
| Compound Name | 2-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]guanidine |
|---|---|
| PubChem CID | 78989893 |
| Molecular Formula | C7H12N4O |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.10 |
| IUPAC Name | 2-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]guanidine |
| SMILES | Cc1noc(C)c1CN=C(N)N |
| InChI | InChI=1S/C7H12N4O/c1-4-6(3-10-7(8)9)5(2)12-11-4/h3H2,1-2H3,(H4,8,9,10) |
| InChIKey | YKRDHACMHKZXMI-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 90.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|