C14H15F3N4O2 — CID 119955496
2-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-1-[2-(trifluoromethoxy)phenyl]guanidine (PubChem CID 119955496) has the molecular formula C14H15F3N4O2 and a molecular weight of 328.29 g/mol. Its IUPAC name is 2-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-1-[2-(trifluoromethoxy)phenyl]guanidine.
| Compound Name | 2-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-1-[2-(trifluoromethoxy)phenyl]guanidine |
|---|---|
| PubChem CID | 119955496 |
| Molecular Formula | C14H15F3N4O2 |
| Molecular Weight | 328.29 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | 2-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-1-[2-(trifluoromethoxy)phenyl]guanidine |
| SMILES | Cc1noc(C)c1C/N=C(\N)Nc1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C14H15F3N4O2/c1-8-10(9(2)23-21-8)7-19-13(18)20-11-5-3-4-6-12(11)22-14(15,16)17/h3-6H,7H2,1-2H3,(H3,18,19,20) |
| InChIKey | QORXMGPNRQTYCP-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 85.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.29 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|