C14H16F3IN4OS — CID 110032796
2-[2-(1,3-thiazol-2-yl)propyl]-1-[2-(trifluoromethoxy)phenyl]guanidine;hydroiodide (PubChem CID 110032796) has the molecular formula C14H16F3IN4OS and a molecular weight of 472.27 g/mol. Its IUPAC name is 2-[2-(1,3-thiazol-2-yl)propyl]-1-[2-(trifluoromethoxy)phenyl]guanidine;hydroiodide.
| Compound Name | 2-[2-(1,3-thiazol-2-yl)propyl]-1-[2-(trifluoromethoxy)phenyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 110032796 |
| Molecular Formula | C14H16F3IN4OS |
| Molecular Weight | 472.27 g/mol |
| Exact Mass | 472.00 |
| IUPAC Name | 2-[2-(1,3-thiazol-2-yl)propyl]-1-[2-(trifluoromethoxy)phenyl]guanidine;hydroiodide |
| SMILES | CC(C/N=C(\N)Nc1ccccc1OC(F)(F)F)c1nccs1.I |
| InChI | InChI=1S/C14H15F3N4OS.HI/c1-9(12-19-6-7-23-12)8-20-13(18)21-10-4-2-3-5-11(10)22-14(15,16)17;/h2-7,9H,8H2,1H3,(H3,18,20,21);1H |
| InChIKey | ORYOZXQBLVLKNH-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 72.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.27 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|