C17H23IN4S — CID 110032765
1-(5,6,7,8-tetrahydronaphthalen-1-yl)-2-[2-(1,3-thiazol-2-yl)propyl]guanidine;hydroiodide (PubChem CID 110032765) has the molecular formula C17H23IN4S and a molecular weight of 442.37 g/mol. Its IUPAC name is 1-(5,6,7,8-tetrahydronaphthalen-1-yl)-2-[2-(1,3-thiazol-2-yl)propyl]guanidine;hydroiodide.
| Compound Name | 1-(5,6,7,8-tetrahydronaphthalen-1-yl)-2-[2-(1,3-thiazol-2-yl)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 110032765 |
| Molecular Formula | C17H23IN4S |
| Molecular Weight | 442.37 g/mol |
| Exact Mass | 442.07 |
| IUPAC Name | 1-(5,6,7,8-tetrahydronaphthalen-1-yl)-2-[2-(1,3-thiazol-2-yl)propyl]guanidine;hydroiodide |
| SMILES | CC(C/N=C(\N)Nc1cccc2c1CCCC2)c1nccs1.I |
| InChI | InChI=1S/C17H22N4S.HI/c1-12(16-19-9-10-22-16)11-20-17(18)21-15-8-4-6-13-5-2-3-7-14(13)15;/h4,6,8-10,12H,2-3,5,7,11H2,1H3,(H3,18,20,21);1H |
| InChIKey | QRQASTULOBEFDD-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.37 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|