C18H24IN3S — CID 111758198
1-(5,6,7,8-tetrahydronaphthalen-1-yl)-2-(2-thiophen-3-ylpropyl)guanidine;hydroiodide (PubChem CID 111758198) has the molecular formula C18H24IN3S and a molecular weight of 441.38 g/mol. Its IUPAC name is 1-(5,6,7,8-tetrahydronaphthalen-1-yl)-2-(2-thiophen-3-ylpropyl)guanidine;hydroiodide.
| Compound Name | 1-(5,6,7,8-tetrahydronaphthalen-1-yl)-2-(2-thiophen-3-ylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111758198 |
| Molecular Formula | C18H24IN3S |
| Molecular Weight | 441.38 g/mol |
| Exact Mass | 441.07 |
| IUPAC Name | 1-(5,6,7,8-tetrahydronaphthalen-1-yl)-2-(2-thiophen-3-ylpropyl)guanidine;hydroiodide |
| SMILES | CC(C/N=C(\N)Nc1cccc2c1CCCC2)c1ccsc1.I |
| InChI | InChI=1S/C18H23N3S.HI/c1-13(15-9-10-22-12-15)11-20-18(19)21-17-8-4-6-14-5-2-3-7-16(14)17;/h4,6,8-10,12-13H,2-3,5,7,11H2,1H3,(H3,19,20,21);1H |
| InChIKey | USBIFAWBLJMNLP-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.38 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|