C20H33N5 — CID 111721293
2-[2-methyl-3-(4-methylpiperazin-1-yl)propyl]-1-(5,6,7,8-tetrahydronaphthalen-1-yl)guanidine (PubChem CID 111721293) has the molecular formula C20H33N5 and a molecular weight of 343.52 g/mol. Its IUPAC name is 2-[2-methyl-3-(4-methylpiperazin-1-yl)propyl]-1-(5,6,7,8-tetrahydronaphthalen-1-yl)guanidine.
| Compound Name | 2-[2-methyl-3-(4-methylpiperazin-1-yl)propyl]-1-(5,6,7,8-tetrahydronaphthalen-1-yl)guanidine |
|---|---|
| PubChem CID | 111721293 |
| Molecular Formula | C20H33N5 |
| Molecular Weight | 343.52 g/mol |
| Exact Mass | 343.27 |
| IUPAC Name | 2-[2-methyl-3-(4-methylpiperazin-1-yl)propyl]-1-(5,6,7,8-tetrahydronaphthalen-1-yl)guanidine |
| SMILES | CC(C/N=C(\N)Nc1cccc2c1CCCC2)CN1CCN(C)CC1 |
| InChI | InChI=1S/C20H33N5/c1-16(15-25-12-10-24(2)11-13-25)14-22-20(21)23-19-9-5-7-17-6-3-4-8-18(17)19/h5,7,9,16H,3-4,6,8,10-15H2,1-2H3,(H3,21,22,23) |
| InChIKey | RZCIJQZGUYWYLV-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 56.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.52 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|