C17H21N3S — CID 111758157
1-(2,3-dihydro-1H-inden-5-yl)-2-(2-thiophen-3-ylpropyl)guanidine (PubChem CID 111758157) has the molecular formula C17H21N3S and a molecular weight of 299.44 g/mol. Its IUPAC name is 1-(2,3-dihydro-1H-inden-5-yl)-2-(2-thiophen-3-ylpropyl)guanidine.
| Compound Name | 1-(2,3-dihydro-1H-inden-5-yl)-2-(2-thiophen-3-ylpropyl)guanidine |
|---|---|
| PubChem CID | 111758157 |
| Molecular Formula | C17H21N3S |
| Molecular Weight | 299.44 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | 1-(2,3-dihydro-1H-inden-5-yl)-2-(2-thiophen-3-ylpropyl)guanidine |
| SMILES | CC(C/N=C(\N)Nc1ccc2c(c1)CCC2)c1ccsc1 |
| InChI | InChI=1S/C17H21N3S/c1-12(15-7-8-21-11-15)10-19-17(18)20-16-6-5-13-3-2-4-14(13)9-16/h5-9,11-12H,2-4,10H2,1H3,(H3,18,19,20) |
| InChIKey | NBPLKWLOSAKDMH-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.44 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|