C15H22F3N5O — CID 119955508
2-[(1,4-dimethylpiperazin-2-yl)methyl]-1-[2-(trifluoromethoxy)phenyl]guanidine (PubChem CID 119955508) has the molecular formula C15H22F3N5O and a molecular weight of 345.37 g/mol. Its IUPAC name is 2-[(1,4-dimethylpiperazin-2-yl)methyl]-1-[2-(trifluoromethoxy)phenyl]guanidine.
| Compound Name | 2-[(1,4-dimethylpiperazin-2-yl)methyl]-1-[2-(trifluoromethoxy)phenyl]guanidine |
|---|---|
| PubChem CID | 119955508 |
| Molecular Formula | C15H22F3N5O |
| Molecular Weight | 345.37 g/mol |
| Exact Mass | 345.18 |
| IUPAC Name | 2-[(1,4-dimethylpiperazin-2-yl)methyl]-1-[2-(trifluoromethoxy)phenyl]guanidine |
| SMILES | CN1CCN(C)C(C/N=C(\N)Nc2ccccc2OC(F)(F)F)C1 |
| InChI | InChI=1S/C15H22F3N5O/c1-22-7-8-23(2)11(10-22)9-20-14(19)21-12-5-3-4-6-13(12)24-15(16,17)18/h3-6,11H,7-10H2,1-2H3,(H3,19,20,21) |
| InChIKey | VTLJWRJKZKFNCJ-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 66.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.37 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|