C16H19F3N4O2 — CID 110018448
2-[(1-cyclopropyl-5-oxopyrrolidin-3-yl)methyl]-1-[2-(trifluoromethoxy)phenyl]guanidine (PubChem CID 110018448) has the molecular formula C16H19F3N4O2 and a molecular weight of 356.35 g/mol. Its IUPAC name is 2-[(1-cyclopropyl-5-oxopyrrolidin-3-yl)methyl]-1-[2-(trifluoromethoxy)phenyl]guanidine.
| Compound Name | 2-[(1-cyclopropyl-5-oxopyrrolidin-3-yl)methyl]-1-[2-(trifluoromethoxy)phenyl]guanidine |
|---|---|
| PubChem CID | 110018448 |
| Molecular Formula | C16H19F3N4O2 |
| Molecular Weight | 356.35 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | 2-[(1-cyclopropyl-5-oxopyrrolidin-3-yl)methyl]-1-[2-(trifluoromethoxy)phenyl]guanidine |
| SMILES | N/C(=N\CC1CC(=O)N(C2CC2)C1)Nc1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C16H19F3N4O2/c17-16(18,19)25-13-4-2-1-3-12(13)22-15(20)21-8-10-7-14(24)23(9-10)11-5-6-11/h1-4,10-11H,5-9H2,(H3,20,21,22) |
| InChIKey | HXSZVPVGNBJTOG-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 79.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.35 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|