C20H24F3IN4O2 — CID 110028833
2-[[2-[(3-hydroxypyrrolidin-1-yl)methyl]phenyl]methyl]-1-[2-(trifluoromethoxy)phenyl]guanidine;hydroiodide (PubChem CID 110028833) has the molecular formula C20H24F3IN4O2 and a molecular weight of 536.34 g/mol. Its IUPAC name is 2-[[2-[(3-hydroxypyrrolidin-1-yl)methyl]phenyl]methyl]-1-[2-(trifluoromethoxy)phenyl]guanidine;hydroiodide.
| Compound Name | 2-[[2-[(3-hydroxypyrrolidin-1-yl)methyl]phenyl]methyl]-1-[2-(trifluoromethoxy)phenyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 110028833 |
| Molecular Formula | C20H24F3IN4O2 |
| Molecular Weight | 536.34 g/mol |
| Exact Mass | 536.09 |
| IUPAC Name | 2-[[2-[(3-hydroxypyrrolidin-1-yl)methyl]phenyl]methyl]-1-[2-(trifluoromethoxy)phenyl]guanidine;hydroiodide |
| SMILES | I.N/C(=N\Cc1ccccc1CN1CCC(O)C1)Nc1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C20H23F3N4O2.HI/c21-20(22,23)29-18-8-4-3-7-17(18)26-19(24)25-11-14-5-1-2-6-15(14)12-27-10-9-16(28)13-27;/h1-8,16,28H,9-13H2,(H3,24,25,26);1H |
| InChIKey | UDDKMOJJPUUKJX-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 83.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.34 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|