C15H20F3N3O2 — CID 122099258
2-[(2,5-dimethyloxolan-3-yl)methyl]-1-[2-(trifluoromethoxy)phenyl]guanidine (PubChem CID 122099258) has the molecular formula C15H20F3N3O2 and a molecular weight of 331.34 g/mol. Its IUPAC name is 2-[(2,5-dimethyloxolan-3-yl)methyl]-1-[2-(trifluoromethoxy)phenyl]guanidine.
| Compound Name | 2-[(2,5-dimethyloxolan-3-yl)methyl]-1-[2-(trifluoromethoxy)phenyl]guanidine |
|---|---|
| PubChem CID | 122099258 |
| Molecular Formula | C15H20F3N3O2 |
| Molecular Weight | 331.34 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | 2-[(2,5-dimethyloxolan-3-yl)methyl]-1-[2-(trifluoromethoxy)phenyl]guanidine |
| SMILES | CC1CC(C/N=C(\N)Nc2ccccc2OC(F)(F)F)C(C)O1 |
| InChI | InChI=1S/C15H20F3N3O2/c1-9-7-11(10(2)22-9)8-20-14(19)21-12-5-3-4-6-13(12)23-15(16,17)18/h3-6,9-11H,7-8H2,1-2H3,(H3,19,20,21) |
| InChIKey | BORWZLJYQFIYHA-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.34 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|