C21H20N4O3S — CID 111064322
2-[[5-(1,3-benzothiazol-2-yl)furan-2-yl]methyl]-1-(2,5-dimethoxyphenyl)guanidine (PubChem CID 111064322) has the molecular formula C21H20N4O3S and a molecular weight of 408.48 g/mol. Its IUPAC name is 2-[[5-(1,3-benzothiazol-2-yl)furan-2-yl]methyl]-1-(2,5-dimethoxyphenyl)guanidine.
| Compound Name | 2-[[5-(1,3-benzothiazol-2-yl)furan-2-yl]methyl]-1-(2,5-dimethoxyphenyl)guanidine |
|---|---|
| PubChem CID | 111064322 |
| Molecular Formula | C21H20N4O3S |
| Molecular Weight | 408.48 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | 2-[[5-(1,3-benzothiazol-2-yl)furan-2-yl]methyl]-1-(2,5-dimethoxyphenyl)guanidine |
| SMILES | COc1ccc(OC)c(N/C(N)=N/Cc2ccc(-c3nc4ccccc4s3)o2)c1 |
| InChI | InChI=1S/C21H20N4O3S/c1-26-13-7-9-17(27-2)16(11-13)25-21(22)23-12-14-8-10-18(28-14)20-24-15-5-3-4-6-19(15)29-20/h3-11H,12H2,1-2H3,(H3,22,23,25) |
| InChIKey | JOVGINPNKJJIAN-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 94.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.48 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|