C15H15N3S — CID 79818277
6-(1,3-benzothiazol-2-ylmethyl)-N-ethylpyridin-2-amine (PubChem CID 79818277) has the molecular formula C15H15N3S and a molecular weight of 269.37 g/mol. Its IUPAC name is 6-(1,3-benzothiazol-2-ylmethyl)-N-ethylpyridin-2-amine.
| Compound Name | 6-(1,3-benzothiazol-2-ylmethyl)-N-ethylpyridin-2-amine |
|---|---|
| PubChem CID | 79818277 |
| Molecular Formula | C15H15N3S |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.10 |
| IUPAC Name | 6-(1,3-benzothiazol-2-ylmethyl)-N-ethylpyridin-2-amine |
| SMILES | CCNc1cccc(Cc2nc3ccccc3s2)n1 |
| InChI | InChI=1S/C15H15N3S/c1-2-16-14-9-5-6-11(17-14)10-15-18-12-7-3-4-8-13(12)19-15/h3-9H,2,10H2,1H3,(H,16,17) |
| InChIKey | VFRDKEGTYBRSNE-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |