C9H9NS3 — CID 152704956
1,3-benzothiazol-2-ylmethylsulfanylmethanethiol (PubChem CID 152704956) has the molecular formula C9H9NS3 and a molecular weight of 227.38 g/mol. Its IUPAC name is 1,3-benzothiazol-2-ylmethylsulfanylmethanethiol.
| Compound Name | 1,3-benzothiazol-2-ylmethylsulfanylmethanethiol |
|---|---|
| PubChem CID | 152704956 |
| Molecular Formula | C9H9NS3 |
| Molecular Weight | 227.38 g/mol |
| Exact Mass | 226.99 |
| IUPAC Name | 1,3-benzothiazol-2-ylmethylsulfanylmethanethiol |
| SMILES | SCSCc1nc2ccccc2s1 |
| InChI | InChI=1S/C9H9NS3/c11-6-12-5-9-10-7-3-1-2-4-8(7)13-9/h1-4,11H,5-6H2 |
| InChIKey | ZSJGLFCLBSIDFQ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 12.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.38 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|