C12H16N2S2 — CID 104631197
1-(1,3-benzothiazol-2-ylmethylsulfanyl)butan-2-amine (PubChem CID 104631197) has the molecular formula C12H16N2S2 and a molecular weight of 252.41 g/mol. Its IUPAC name is 1-(1,3-benzothiazol-2-ylmethylsulfanyl)butan-2-amine.
| Compound Name | 1-(1,3-benzothiazol-2-ylmethylsulfanyl)butan-2-amine |
|---|---|
| PubChem CID | 104631197 |
| Molecular Formula | C12H16N2S2 |
| Molecular Weight | 252.41 g/mol |
| Exact Mass | 252.08 |
| IUPAC Name | 1-(1,3-benzothiazol-2-ylmethylsulfanyl)butan-2-amine |
| SMILES | CCC(N)CSCc1nc2ccccc2s1 |
| InChI | InChI=1S/C12H16N2S2/c1-2-9(13)7-15-8-12-14-10-5-3-4-6-11(10)16-12/h3-6,9H,2,7-8,13H2,1H3 |
| InChIKey | LCDSNAOJCOSDJW-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.41 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |