C11H13NOS2 — CID 104631541
3-(1,3-benzothiazol-2-ylmethylsulfanyl)propan-1-ol (PubChem CID 104631541) has the molecular formula C11H13NOS2 and a molecular weight of 239.36 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-2-ylmethylsulfanyl)propan-1-ol.
| Compound Name | 3-(1,3-benzothiazol-2-ylmethylsulfanyl)propan-1-ol |
|---|---|
| PubChem CID | 104631541 |
| Molecular Formula | C11H13NOS2 |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.04 |
| IUPAC Name | 3-(1,3-benzothiazol-2-ylmethylsulfanyl)propan-1-ol |
| SMILES | OCCCSCc1nc2ccccc2s1 |
| InChI | InChI=1S/C11H13NOS2/c13-6-3-7-14-8-11-12-9-4-1-2-5-10(9)15-11/h1-2,4-5,13H,3,6-8H2 |
| InChIKey | MDIYBUHRWKDEKV-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|