C21H16N6S5 — CID 70676975
4,6-diamino-5-[bis(1,3-benzothiazol-2-ylmethylsulfanyl)methylidene]pyrimidine-2-thione (PubChem CID 70676975) has the molecular formula C21H16N6S5 and a molecular weight of 512.74 g/mol. Its IUPAC name is 4,6-diamino-5-[bis(1,3-benzothiazol-2-ylmethylsulfanyl)methylidene]pyrimidine-2-thione.
| Compound Name | 4,6-diamino-5-[bis(1,3-benzothiazol-2-ylmethylsulfanyl)methylidene]pyrimidine-2-thione |
|---|---|
| PubChem CID | 70676975 |
| Molecular Formula | C21H16N6S5 |
| Molecular Weight | 512.74 g/mol |
| Exact Mass | 512.00 |
| IUPAC Name | 4,6-diamino-5-[bis(1,3-benzothiazol-2-ylmethylsulfanyl)methylidene]pyrimidine-2-thione |
| SMILES | NC1=NC(=S)N=C(N)C1=C(SCc1nc2ccccc2s1)SCc1nc2ccccc2s1 |
| InChI | InChI=1S/C21H16N6S5/c22-18-17(19(23)27-21(28)26-18)20(29-9-15-24-11-5-1-3-7-13(11)31-15)30-10-16-25-12-6-2-4-8-14(12)32-16/h1-8H,9-10H2,(H4,22,23,26,27,28) |
| InChIKey | SLYKFLUFTYAJLP-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 102.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.74 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|