C18H20N2OS — CID 71198623
1-[4-(1,3-benzothiazol-2-ylmethyl)phenoxy]butan-2-amine (PubChem CID 71198623) has the molecular formula C18H20N2OS and a molecular weight of 312.44 g/mol. Its IUPAC name is 1-[4-(1,3-benzothiazol-2-ylmethyl)phenoxy]butan-2-amine.
| Compound Name | 1-[4-(1,3-benzothiazol-2-ylmethyl)phenoxy]butan-2-amine |
|---|---|
| PubChem CID | 71198623 |
| Molecular Formula | C18H20N2OS |
| Molecular Weight | 312.44 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | 1-[4-(1,3-benzothiazol-2-ylmethyl)phenoxy]butan-2-amine |
| SMILES | CCC(N)COc1ccc(Cc2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C18H20N2OS/c1-2-14(19)12-21-15-9-7-13(8-10-15)11-18-20-16-5-3-4-6-17(16)22-18/h3-10,14H,2,11-12,19H2,1H3 |
| InChIKey | CHROXATWXVDMGN-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.44 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |