C18H20N2S — CID 105016121
1-(1,3-benzothiazol-2-yl)-3-phenylpentan-2-amine (PubChem CID 105016121) has the molecular formula C18H20N2S and a molecular weight of 296.44 g/mol. Its IUPAC name is 1-(1,3-benzothiazol-2-yl)-3-phenylpentan-2-amine.
| Compound Name | 1-(1,3-benzothiazol-2-yl)-3-phenylpentan-2-amine |
|---|---|
| PubChem CID | 105016121 |
| Molecular Formula | C18H20N2S |
| Molecular Weight | 296.44 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | 1-(1,3-benzothiazol-2-yl)-3-phenylpentan-2-amine |
| SMILES | CCC(c1ccccc1)C(N)Cc1nc2ccccc2s1 |
| InChI | InChI=1S/C18H20N2S/c1-2-14(13-8-4-3-5-9-13)15(19)12-18-20-16-10-6-7-11-17(16)21-18/h3-11,14-15H,2,12,19H2,1H3 |
| InChIKey | SLGXAXZHMCMMAE-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.44 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |