C16H19ClN2S — CID 102682137
6-[(3-chloro-1-benzothiophen-2-yl)methyl]-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridine (PubChem CID 102682137) has the molecular formula C16H19ClN2S and a molecular weight of 306.86 g/mol. Its IUPAC name is 6-[(3-chloro-1-benzothiophen-2-yl)methyl]-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridine.
| Compound Name | 6-[(3-chloro-1-benzothiophen-2-yl)methyl]-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridine |
|---|---|
| PubChem CID | 102682137 |
| Molecular Formula | C16H19ClN2S |
| Molecular Weight | 306.86 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | 6-[(3-chloro-1-benzothiophen-2-yl)methyl]-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridine |
| SMILES | Clc1c(CN2CC3CCCNC3C2)sc2ccccc12 |
| InChI | InChI=1S/C16H19ClN2S/c17-16-12-5-1-2-6-14(12)20-15(16)10-19-8-11-4-3-7-18-13(11)9-19/h1-2,5-6,11,13,18H,3-4,7-10H2 |
| InChIKey | MPYODOVJOGZEPO-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.86 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |