C17H23N3O — CID 97452906
[(3aR,6aS)-2-(pyridin-3-ylmethyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-cyclobutylmethanone (PubChem CID 97452906) has the molecular formula C17H23N3O and a molecular weight of 285.39 g/mol. Its IUPAC name is [(3aR,6aS)-2-(pyridin-3-ylmethyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-cyclobutylmethanone.
| Compound Name | [(3aR,6aS)-2-(pyridin-3-ylmethyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-cyclobutylmethanone |
|---|---|
| PubChem CID | 97452906 |
| Molecular Formula | C17H23N3O |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.18 |
| IUPAC Name | [(3aR,6aS)-2-(pyridin-3-ylmethyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-cyclobutylmethanone |
| SMILES | O=C(C1CCC1)N1C[C@H]2CN(Cc3cccnc3)C[C@H]2C1 |
| InChI | InChI=1S/C17H23N3O/c21-17(14-4-1-5-14)20-11-15-9-19(10-16(15)12-20)8-13-3-2-6-18-7-13/h2-3,6-7,14-16H,1,4-5,8-12H2/t15-,16+ |
| InChIKey | RIOWZQVPUPPJKY-IYBDPMFKSA-N |
| XLogP | 1.77 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |