C21H21N5S — CID 163345011
2-[5-(4-ethyl-1,3-benzothiazol-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]pyridine-3-carbonitrile (PubChem CID 163345011) has the molecular formula C21H21N5S and a molecular weight of 375.50 g/mol. Its IUPAC name is 2-[5-(4-ethyl-1,3-benzothiazol-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]pyridine-3-carbonitrile.
| Compound Name | 2-[5-(4-ethyl-1,3-benzothiazol-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 163345011 |
| Molecular Formula | C21H21N5S |
| Molecular Weight | 375.50 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | 2-[5-(4-ethyl-1,3-benzothiazol-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]pyridine-3-carbonitrile |
| SMILES | CCc1cccc2sc(N3CC4CN(c5ncccc5C#N)CC4C3)nc12 |
| InChI | InChI=1S/C21H21N5S/c1-2-14-5-3-7-18-19(14)24-21(27-18)26-12-16-10-25(11-17(16)13-26)20-15(9-22)6-4-8-23-20/h3-8,16-17H,2,10-13H2,1H3 |
| InChIKey | VLOQLXQUBBDERP-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 56.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.50 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |