C24H37Cl2N3O3 — CID 171321841
[(2R,4R)-4-hydroxypyrrolidin-2-yl]-[(1R,2S,8S,9S)-8-[(3-methoxyphenyl)methyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]methanone;dihydrochloride (PubChem CID 171321841) has the molecular formula C24H37Cl2N3O3 and a molecular weight of 486.48 g/mol. Its IUPAC name is [(2R,4R)-4-hydroxypyrrolidin-2-yl]-[(1R,2S,8S,9S)-8-[(3-methoxyphenyl)methyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]methanone;dihydrochloride.
| Compound Name | [(2R,4R)-4-hydroxypyrrolidin-2-yl]-[(1R,2S,8S,9S)-8-[(3-methoxyphenyl)methyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]methanone;dihydrochloride |
|---|---|
| PubChem CID | 171321841 |
| Molecular Formula | C24H37Cl2N3O3 |
| Molecular Weight | 486.48 g/mol |
| Exact Mass | 485.22 |
| IUPAC Name | [(2R,4R)-4-hydroxypyrrolidin-2-yl]-[(1R,2S,8S,9S)-8-[(3-methoxyphenyl)methyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]methanone;dihydrochloride |
| SMILES | COc1cccc(C[C@H]2[C@H]3C[C@H](CN(C(=O)[C@H]4C[C@@H](O)CN4)C3)[C@@H]3CCCCN32)c1.Cl.Cl |
| InChI | InChI=1S/C24H35N3O3.2ClH/c1-30-20-6-4-5-16(9-20)10-23-18-11-17(22-7-2-3-8-27(22)23)14-26(15-18)24(29)21-12-19(28)13-25-21;;/h4-6,9,17-19,21-23,25,28H,2-3,7-8,10-15H2,1H3;2*1H/t17-,18+,19-,21-,22+,23+;;/m1../s1 |
| InChIKey | SLLLECAOLCNWDZ-PCGWTHHMSA-N |
| XLogP | 2.51 |
| TPSA | 65.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.48 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |