C21H30N2O3 — CID 165419211
2-hydroxy-1-[(1R,2S,8S,9S)-8-[(3-methoxyphenyl)methyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]ethanone (PubChem CID 165419211) has the molecular formula C21H30N2O3 and a molecular weight of 358.48 g/mol. Its IUPAC name is 2-hydroxy-1-[(1R,2S,8S,9S)-8-[(3-methoxyphenyl)methyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]ethanone.
| Compound Name | 2-hydroxy-1-[(1R,2S,8S,9S)-8-[(3-methoxyphenyl)methyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]ethanone |
|---|---|
| PubChem CID | 165419211 |
| Molecular Formula | C21H30N2O3 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.23 |
| IUPAC Name | 2-hydroxy-1-[(1R,2S,8S,9S)-8-[(3-methoxyphenyl)methyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]ethanone |
| SMILES | COc1cccc(C[C@H]2[C@H]3C[C@H](CN(C(=O)CO)C3)[C@@H]3CCCCN32)c1 |
| InChI | InChI=1S/C21H30N2O3/c1-26-18-6-4-5-15(9-18)10-20-17-11-16(12-22(13-17)21(25)14-24)19-7-2-3-8-23(19)20/h4-6,9,16-17,19-20,24H,2-3,7-8,10-14H2,1H3/t16-,17+,19+,20+/m1/s1 |
| InChIKey | UJEYBAQENMBCNU-UMGGQSCQSA-N |
| XLogP | 1.93 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |