C21H29ClN2O4 — CID 171712613
2-(3-chlorophenyl)-1-[(1R,2S,8R,9S)-8-(hydroxymethyl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]ethanone;formic acid (PubChem CID 171712613) has the molecular formula C21H29ClN2O4 and a molecular weight of 408.93 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-1-[(1R,2S,8R,9S)-8-(hydroxymethyl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]ethanone;formic acid.
| Compound Name | 2-(3-chlorophenyl)-1-[(1R,2S,8R,9S)-8-(hydroxymethyl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]ethanone;formic acid |
|---|---|
| PubChem CID | 171712613 |
| Molecular Formula | C21H29ClN2O4 |
| Molecular Weight | 408.93 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | 2-(3-chlorophenyl)-1-[(1R,2S,8R,9S)-8-(hydroxymethyl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]ethanone;formic acid |
| SMILES | O=C(Cc1cccc(Cl)c1)N1C[C@H]2C[C@@H](C1)[C@H](CO)N1CCCC[C@@H]21.O=CO |
| InChI | InChI=1S/C20H27ClN2O2.CH2O2/c21-17-5-3-4-14(8-17)9-20(25)22-11-15-10-16(12-22)19(13-24)23-7-2-1-6-18(15)23;2-1-3/h3-5,8,15-16,18-19,24H,1-2,6-7,9-13H2;1H,(H,2,3)/t15-,16+,18+,19+;/m1./s1 |
| InChIKey | RMGBCOUGRBQIQZ-JNDCXILUSA-N |
| XLogP | 2.28 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.93 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|