C22H30N6O4 — CID 171710923
formic acid;1-[(1R,2S,8R,9S)-8-(hydroxymethyl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]-2-(3-pyridin-4-yl-1H-1,2,4-triazol-5-yl)ethanone (PubChem CID 171710923) has the molecular formula C22H30N6O4 and a molecular weight of 442.52 g/mol. Its IUPAC name is formic acid;1-[(1R,2S,8R,9S)-8-(hydroxymethyl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]-2-(3-pyridin-4-yl-1H-1,2,4-triazol-5-yl)ethanone.
| Compound Name | formic acid;1-[(1R,2S,8R,9S)-8-(hydroxymethyl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]-2-(3-pyridin-4-yl-1H-1,2,4-triazol-5-yl)ethanone |
|---|---|
| PubChem CID | 171710923 |
| Molecular Formula | C22H30N6O4 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.23 |
| IUPAC Name | formic acid;1-[(1R,2S,8R,9S)-8-(hydroxymethyl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]-2-(3-pyridin-4-yl-1H-1,2,4-triazol-5-yl)ethanone |
| SMILES | O=C(Cc1nc(-c2ccncc2)n[nH]1)N1C[C@H]2C[C@@H](C1)[C@H](CO)N1CCCC[C@@H]21.O=CO |
| InChI | InChI=1S/C21H28N6O2.CH2O2/c28-13-18-16-9-15(17-3-1-2-8-27(17)18)11-26(12-16)20(29)10-19-23-21(25-24-19)14-4-6-22-7-5-14;2-1-3/h4-7,15-18,28H,1-3,8-13H2,(H,23,24,25);1H,(H,2,3)/t15-,16+,17+,18+;/m1./s1 |
| InChIKey | OBCCDGWSWHUVHJ-BTHRPWOVSA-N |
| XLogP | 0.80 |
| TPSA | 135.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|