C23H38N4O3 — CID 166598317
formic acid;1-[(1R,2S,8S,9S)-8-(3-methylbutyl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]-3-(1H-pyrazol-4-yl)propan-1-one (PubChem CID 166598317) has the molecular formula C23H38N4O3 and a molecular weight of 418.58 g/mol. Its IUPAC name is formic acid;1-[(1R,2S,8S,9S)-8-(3-methylbutyl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]-3-(1H-pyrazol-4-yl)propan-1-one.
| Compound Name | formic acid;1-[(1R,2S,8S,9S)-8-(3-methylbutyl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]-3-(1H-pyrazol-4-yl)propan-1-one |
|---|---|
| PubChem CID | 166598317 |
| Molecular Formula | C23H38N4O3 |
| Molecular Weight | 418.58 g/mol |
| Exact Mass | 418.29 |
| IUPAC Name | formic acid;1-[(1R,2S,8S,9S)-8-(3-methylbutyl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]-3-(1H-pyrazol-4-yl)propan-1-one |
| SMILES | CC(C)CC[C@H]1[C@H]2C[C@H](CN(C(=O)CCc3cn[nH]c3)C2)[C@@H]2CCCCN21.O=CO |
| InChI | InChI=1S/C22H36N4O.CH2O2/c1-16(2)6-8-21-19-11-18(20-5-3-4-10-26(20)21)14-25(15-19)22(27)9-7-17-12-23-24-13-17;2-1-3/h12-13,16,18-21H,3-11,14-15H2,1-2H3,(H,23,24);1H,(H,2,3)/t18-,19+,20+,21+;/m1./s1 |
| InChIKey | XMTABSKWTIERQP-DMTXAUIDSA-N |
| XLogP | 3.18 |
| TPSA | 89.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.58 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|